CymitQuimica logo

CAS 84409-70-1

:

(4S,5S)-(+)-4,5-Bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane

Description:
(4S,5S)-(+)-4,5-Bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane is a chiral organic compound characterized by its unique dioxolane structure, which features a five-membered ring containing two oxygen atoms. The presence of fluoromethyl groups at the 4 and 5 positions contributes to its reactivity and potential applications in medicinal chemistry and material science. The compound's stereochemistry, indicated by the (4S,5S) configuration, suggests that it has specific spatial arrangements that can influence its biological activity and interactions with other molecules. Its dimethyl substitution at the 2,2 positions enhances its steric properties, potentially affecting its solubility and stability. As a fluorinated compound, it may exhibit distinct physical and chemical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Overall, this compound's unique structure and properties make it of interest for further research and development in various chemical applications.
Formula:C7H12F2O2
InChI:InChI=1/C7H12F2O2/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1
SMILES:CC1(C)O[C@H](CF)[C@@H](CF)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.