CAS 84434-83-3

N'-(4-chlorobenzyl)-N,N-diethylethane-1,2-diamine

Description:

N'-(4-chlorobenzyl)-N,N-diethylethane-1,2-diamine is an organic compound characterized by its amine functional groups and a chlorobenzyl substituent. It features a central ethane backbone with two ethyl groups attached to one nitrogen atom and a 4-chlorobenzyl group linked to the other nitrogen. This structure imparts both hydrophilic and hydrophobic characteristics, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances the compound's reactivity and may influence its biological activity. As a diamine, it can participate in various chemical reactions, such as forming salts or undergoing acylation. The compound's solubility is likely influenced by the balance between its hydrophilic amine groups and the hydrophobic aromatic ring. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, N'-(4-chlorobenzyl)-N,N-diethylethane-1,2-diamine is a versatile compound with potential applications in synthetic chemistry and material science.

Formula: C₁₃H₂₁ClN₂

InChI: InChI=1/C13H21ClN2/c1-3-16(4-2)10-9-15-11-12-5-7-13(14)8-6-12/h5-8,15H,3-4,9-11H2,1-2H3

[(4-Chlorophenyl)methyl][2-(diethylamino)ethyl]amine

CAS: 84434-83-3

Versatile small molecule scaffold

Formula: C₁₃H₂₁ClN₂

Purity: Min. 95%

Molecular weight: 240.77 g/mol

Ref: 3D-JDA43483