CAS 84444-90-6
:1-deoxymannojirimycin hydrochloride
Description:
1-Deoxymannojirimycin hydrochloride is a synthetic compound that belongs to the class of iminosugars, which are structurally similar to monosaccharides but contain a nitrogen atom in place of an oxygen atom. This compound is characterized by its ability to inhibit certain glycosidases, enzymes that play a crucial role in carbohydrate metabolism. As a result, it has garnered interest in pharmaceutical research, particularly for its potential applications in treating viral infections and certain metabolic disorders. The hydrochloride salt form enhances its solubility in water, making it more bioavailable for biological studies. 1-Deoxymannojirimycin hydrochloride is typically a white to off-white crystalline powder, and it is soluble in water and methanol. Its mechanism of action involves the competitive inhibition of glycosidases, which can lead to altered glycoprotein processing and has implications in therapeutic strategies against diseases such as diabetes and viral infections. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential health risks.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1
SMILES:C1[C@H]([C@H]([C@@H]([C@@H](CO)N1)O)O)O
Synonyms:- 1-Deoxymannojirimycin, HCl
- (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Deoxymannojirimycin
CAS:Deoxymannojirimycin is a natural product that belongs to the group of mannojirimycins. It has been shown to have an inhibitory effect on the activity of matrix metalloproteinase-9 (MMP-9) in vitro, which is involved in the degradation of extracellular matrix. Deoxymannojirimycin also has hypoglycemic effects and can be used as a potential oral antidiabetic drug. The inhibition of MMP-9 may also be due to its binding to integrin receptors. In addition, deoxymannojirimycin has been shown to have anti-inflammatory properties in vitro and can inhibit the growth of oral pathogens, including Streptococcus mutans, Streptococcus sobrinus, and Porphyromonas gingivalis. Furthermore, deoxymannojirimycin has been found to have thermodynamic data and analytical methods thatPurity:Min. 95%

