CAS 84445-91-0

1-(7-Methyl-1H-benzimidazol-1-yl)ethanone

Description:

1-(7-Methyl-1H-benzimidazol-1-yl)ethanone, with the CAS number 84445-91-0, is an organic compound characterized by its benzimidazole structure, which is a fused bicyclic system containing both benzene and imidazole rings. This compound features a methyl group at the 7-position of the benzimidazole ring and an ethanone functional group, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The presence of the benzimidazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the carbonyl group. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral properties, would be determined through experimental methods, providing insights into its stability and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c1-7-4-3-5-9-10(7)12(6-11-9)8(2)13/h3-6H,1-2H3

InChI key: InChIKey=RPBZNJDPUDRUSO-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(N=C1)=CC=CC2C

Synonyms:

• 1-(7-Methyl-1H-benzimidazol-1-yl)ethanone
• Ethanone, 1-(7-methyl-1H-benzimidazol-1-yl)-
• 1H-Benzimidazole, 1-acetyl-7-methyl-
• 1-(7-Methyl-1H-1,3-benzodiazol-1-yl)ethan-1-one
• 1-(7-Methyl-1H-benzo[d]imidazol-1-yl)ethanone