CAS 844499-00-9
:3-(chloromethyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole
Description:
3-(Chloromethyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. The compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. Additionally, the presence of a 2-fluorophenyl substituent contributes to its unique electronic properties and may influence its biological activity. This compound is typically synthesized through specific organic reactions that introduce the chloromethyl and fluorophenyl groups onto the oxadiazole framework. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, owing to its potential as a building block for more complex molecules. The compound's properties, such as solubility, stability, and reactivity, can vary based on the functional groups attached to the oxadiazole ring, making it a subject of interest in synthetic chemistry and drug development.
Formula:C9H6ClFN2O
InChI:InChI=1/C9H6ClFN2O/c10-5-8-12-9(14-13-8)6-3-1-2-4-7(6)11/h1-4H,5H2
SMILES:c1ccc(c(c1)c1nc(CCl)no1)F
Synonyms:- 1,2,4-Oxadiazole, 3-(Chloromethyl)-5-(2-Fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
