CAS 84460-41-3
:5-(hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one
Description:
5-(Hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one, with the CAS number 84460-41-3, is a chemical compound characterized by its oxazolidinone structure, which includes a five-membered ring containing both oxygen and nitrogen atoms. This compound features a hydroxymethyl group and a 4-iodophenyl substituent, contributing to its unique chemical properties. The presence of the iodine atom enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of antimicrobial agents. The hydroxymethyl group can participate in hydrogen bonding, influencing the compound's solubility and interaction with biological targets. Additionally, the oxazolidinone framework is known for its role in various pharmaceutical applications, including as a scaffold for antibiotic development. Overall, this compound's structural features suggest potential utility in drug design and synthesis, particularly in the context of developing new therapeutic agents with specific biological activities.
Formula:C10H10INO3
InChI:InChI=1/C10H10INO3/c11-7-1-3-8(4-2-7)12-5-9(6-13)15-10(12)14/h1-4,9,13H,5-6H2
Synonyms:- 2-Oxazolidinone, 5-(Hydroxymethyl)-3-(4-Iodophenyl)-
- 5-(Hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
