CAS 844639-06-1
:11-[4-[2-[2-(Triphenylmethoxy)ethoxy]ethyl]-1-piperazinyl]dibenzo[b,f][1,4]thiazepine
Description:
The chemical substance known as 11-[4-[2-[2-(Triphenylmethoxy)ethoxy]ethyl]-1-piperazinyl]dibenzo[b,f][1,4]thiazepine, with the CAS number 844639-06-1, is a complex organic compound characterized by its unique structural features. It contains a dibenzo[b,f][1,4]thiazepine core, which is a bicyclic structure that incorporates both sulfur and nitrogen atoms, contributing to its potential biological activity. The presence of a piperazine moiety suggests possible interactions with neurotransmitter receptors, making it of interest in pharmacological research. Additionally, the triphenylmethoxy group indicates a high degree of steric bulk, which may influence the compound's solubility and binding properties. This compound is likely to exhibit specific pharmacokinetic and pharmacodynamic profiles, making it a candidate for further investigation in medicinal chemistry. Its synthesis and characterization would involve advanced organic chemistry techniques, and its potential applications could span various therapeutic areas, particularly in the treatment of neurological or psychiatric disorders.
Formula:C40H39N3O2S
InChI:InChI=1S/C40H39N3O2S/c1-4-14-32(15-5-1)40(33-16-6-2-7-17-33,34-18-8-3-9-19-34)45-31-30-44-29-28-42-24-26-43(27-25-42)39-35-20-10-12-22-37(35)46-38-23-13-11-21-36(38)41-39/h1-23H,24-31H2
InChI key:InChIKey=WQIGEAROXHRMLY-UHFFFAOYSA-N
SMILES:C(OCCOCCN1CCN(CC1)C=2C=3C(SC=4C(N2)=CC=CC4)=CC=CC3)(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7
Synonyms:- 11-[4-[2-[2-(Triphenylmethoxy)ethoxy]ethyl]-1-piperazinyl]dibenzo[b,f][1,4]thiazepine
- Dibenzo[b,f][1,4]thiazepine, 11-[4-[2-[2-(triphenylmethoxy)ethoxy]ethyl]-1-piperazinyl]-
- 11-[4-[2-(2-Trityloxyethoxy)ethyl]piperazin-1-yl]dibenzo[b,f][a,4]thiazepine
- 11-(4-(2-(2-Triphenylmethoxyethoxy)-ethyl)piperazin-1-yl)dibenzo(b,f)(1,4)thiazepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
O-Triphenylmethoxy Quetiapine
CAS:<p>Applications O-Triphenylmethoxy Quetiapine is an impurity of Quetiapine hemifumarate (Q510000), a dibenzothiazepine antipsychotic medication used in the treatment of schizophrenia.<br>References Kumar, K., et al.: Org. Chem.: An Indian Journal, 8, 164 (2012); Raju, I., et al.: Chromatographia, 70, 545 (2009)<br></p>Formula:C40H39N3O2SColor and Shape:Off-White To Light YellowMolecular weight:625.82O-Triphenylmethoxy Quetiapine-D8
CAS:Controlled ProductFormula:C40D8H31N3O2SColor and Shape:NeatMolecular weight:633.871


