CAS 84467-55-0
:N,N-Dimethyl-α-(2-methylpropyl)-1-phenylcyclobutanemethanamine
Description:
N,N-Dimethyl-α-(2-methylpropyl)-1-phenylcyclobutanemethanamine, with the CAS number 84467-55-0, is a chemical compound that belongs to the class of amines. It features a cyclobutane ring, which contributes to its unique structural properties. The presence of a phenyl group and a dimethylamino group enhances its potential for various interactions, making it of interest in medicinal chemistry and pharmacology. This compound is characterized by its relatively complex structure, which includes a branched alkyl chain (2-methylpropyl) that may influence its solubility and reactivity. As an amine, it may exhibit basic properties and can participate in hydrogen bonding, affecting its behavior in biological systems. The compound's specific applications and effects would depend on its interaction with biological targets, making it a subject of research in drug development and related fields. Safety and handling considerations are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C17H27N
InChI:InChI=1S/C17H27N/c1-14(2)13-16(18(3)4)17(11-8-12-17)15-9-6-5-7-10-15/h5-7,9-10,14,16H,8,11-13H2,1-4H3
InChI key:InChIKey=BZGCSSIIQDTVKA-UHFFFAOYSA-N
SMILES:C(CC(C)C)(N(C)C)C1(CCC1)C2=CC=CC=C2
Synonyms:- Cyclobutanemethanamine, N,N-dimethyl-α-(2-methylpropyl)-1-phenyl-
- N,N-Dimethyl-α-(2-methylpropyl)-1-phenylcyclobutanemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
