CAS 84468-15-5

5-Isoquinolinesulfonyl chloride

Description:

5-Isoquinolinesulfonyl chloride is an organic compound characterized by the presence of an isoquinoline moiety and a sulfonyl chloride functional group. It typically appears as a white to off-white solid and is known for its reactivity, particularly due to the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. This compound is often utilized in organic synthesis, particularly in the preparation of sulfonamide derivatives and as a reagent for the introduction of sulfonyl groups into various organic molecules. Its structure allows for the formation of diverse chemical bonds, making it valuable in medicinal chemistry and the development of pharmaceuticals. Additionally, 5-Isoquinolinesulfonyl chloride is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper storage conditions and safety precautions are essential when working with this compound to prevent degradation and ensure safe handling.

Formula: C₉H₆ClNO₂S

InChI: InChI=1S/C9H6ClNO2S/c10-14(12,13)9-3-1-2-7-6-11-5-4-8(7)9/h1-6H

InChI key: InChIKey=WHIDHHUCCTYJKA-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C2=C(C=CC1)C=NC=C2

Synonyms:

• 5-Isoquinolinesulfonyl Chloride
• Isoquinoline-5-sulfonyl chloride

Isoquinoline-5-sulfonyl chloride

CAS: 84468-15-5

Formula: C₉H₆ClNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.6674

Ref: IN-DA008I27

Isoquinoline-5-sulfonyl chloride

CAS: 84468-15-5

Isoquinoline-5-sulfonyl chloride

Purity: 98%

Molecular weight: 227.67g/mol

Ref: 54-OR1033904

Isoquinoline-5-sulfonyl chloride

CAS: 84468-15-5

Formula: C₉H₆ClNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.66

Ref: 10-F217137