
CAS 844681-82-9
:B-[2-[2-(1-Methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]boronic acid
Description:
B-[2-[2-(1-Methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]boronic acid, with CAS number 844681-82-9, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a tetrazole moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. Additionally, the compound's structure suggests it may participate in coordination chemistry, potentially interacting with metal ions. Its solubility and stability can vary depending on the solvent and pH, which are important factors to consider in practical applications. Overall, this compound represents a versatile building block in the development of pharmaceuticals and materials science.
Formula:C16H17BN4O2
InChI:InChI=1S/C16H17BN4O2/c1-16(2,12-8-4-3-5-9-12)21-19-15(18-20-21)13-10-6-7-11-14(13)17(22)23/h3-11,22-23H,1-2H3
InChI key:InChIKey=NNTKUSBWPSUUFD-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C2=NN(C(C)(C)C3=CC=CC=C3)N=N2)C=CC=C1
Synonyms:- Boronic acid, B-[2-[2-(1-methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]-
- (2-(2-(1-Methyl-1-phenyl-ethyl)-2H-tetrazol-5-yl)-phenyl)-boronic acid
- B-[2-[2-(1-Methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]boronic acid
- Boronic acid, [2-[2-(1-methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, B-[2-[2-(1-methyl-1-phenylethyl)-2H-tetrazol-5-yl]phenyl]-
CAS:Formula:C16H17BN4O2Molecular weight:308.1428
