CAS 844683-29-0

Benzenemethanol, α-(4-ethylphenyl)-3-methyl-

Description:

Benzenemethanol, α-(4-ethylphenyl)-3-methyl-, also known by its CAS number 844683-29-0, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a methanol group and additional ethyl and methyl groups, which contribute to its unique properties. This compound is likely to exhibit moderate polarity due to the presence of the hydroxyl (-OH) group, influencing its solubility in various solvents. The presence of multiple alkyl substituents can enhance its hydrophobic characteristics, affecting its interactions in biological and chemical systems. Additionally, the compound may demonstrate interesting reactivity patterns typical of aromatic compounds, such as electrophilic substitution. Its structural complexity suggests potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. However, specific physical properties such as boiling point, melting point, and density would require empirical data for precise characterization. Safety data should also be consulted to understand its handling and potential hazards.

Formula: C₁₆H₁₈O

InChI: InChI=1S/C16H18O/c1-3-13-7-9-14(10-8-13)16(17)15-6-4-5-12(2)11-15/h4-11,16-17H,3H2,1-2H3

InChI key: InChIKey=QWJIFEMHQGINKX-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(C)=CC=C1)C2=CC=C(CC)C=C2

Synonyms:

• Benzenemethanol, α-(4-ethylphenyl)-3-methyl-