CAS 844683-38-1

α-(4-Chlorophenyl)-3,5-difluorobenzenemethanol

Description:

α-(4-Chlorophenyl)-3,5-difluorobenzenemethanol, with the CAS number 844683-38-1, is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with both chlorine and fluorine atoms, as well as a hydroxymethyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the chlorophenyl group suggests that it may have significant lipophilicity, which can influence its solubility in organic solvents. The difluoromethyl substituents can enhance the compound's reactivity and may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the hydroxymethyl group can participate in hydrogen bonding, affecting the compound's physical properties, such as boiling and melting points. Overall, this compound's unique combination of substituents may lead to interesting applications in pharmaceuticals or agrochemicals, although specific biological or chemical activities would require further investigation.

Formula: C₁₃H₉ClF₂O

InChI: InChI=1S/C13H9ClF2O/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13,17H

InChI key: InChIKey=FLUYWFRZYKPTTH-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(F)=CC(F)=C1)C2=CC=C(Cl)C=C2

Synonyms:

• Benzenemethanol, α-(4-chlorophenyl)-3,5-difluoro-
• α-(4-Chlorophenyl)-3,5-difluorobenzenemethanol

4-Chloro-3',5'-difluorobenzhydrol

CAS: 844683-38-1

4-Chloro-3',5'-difluorobenzhydrol

Purity: 97%

Molecular weight: 254.66g/mol

Ref: 54-PC2587