CAS 844683-39-2
:α-(4-Chlorophenyl)-3,4-dimethoxybenzenemethanol
Description:
α-(4-Chlorophenyl)-3,4-dimethoxybenzenemethanol, identified by its CAS number 844683-39-2, is an organic compound characterized by its complex aromatic structure. This substance features a chlorophenyl group, which contributes to its potential biological activity, and two methoxy groups that enhance its solubility and reactivity. The presence of the hydroxymethyl group indicates that it can participate in hydrogen bonding, influencing its physical properties and interactions. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests that it may have moderate lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the chlorinated aromatic ring may impart unique electronic properties, potentially influencing its reactivity and interactions with biological targets. Overall, α-(4-Chlorophenyl)-3,4-dimethoxybenzenemethanol represents a class of compounds that could be explored for various applications, particularly in drug development and chemical synthesis.
Formula:C15H15ClO3
InChI:InChI=1S/C15H15ClO3/c1-18-13-8-5-11(9-14(13)19-2)15(17)10-3-6-12(16)7-4-10/h3-9,15,17H,1-2H3
InChI key:InChIKey=GYACTWDYQKDXNM-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=C(OC)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- Benzenemethanol, α-(4-chlorophenyl)-3,4-dimethoxy-
- α-(4-Chlorophenyl)-3,4-dimethoxybenzenemethanol
- (4-Chlorophenyl)(3,4-dimethoxyphenyl)methanol
- 4-CHLORO-3',4'-DIMETHOXYBENZHYDROL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.