CAS 844683-40-5
:4-Chloro-α-[4-(dimethylamino)phenyl]benzenemethanol
Description:
4-Chloro-α-[4-(dimethylamino)phenyl]benzenemethanol, with the CAS number 844683-40-5, is an organic compound characterized by its complex structure, which includes a chloro substituent and a dimethylamino group attached to a phenyl ring. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the hydroxymethyl group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the chloro group can enhance the compound's electrophilic character, making it potentially reactive in various chemical reactions. The dimethylamino group may impart basicity and influence the compound's interaction with biological systems, possibly affecting its pharmacological properties. Overall, this compound's unique functional groups contribute to its potential applications in fields such as medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C15H16ClNO
InChI:InChI=1S/C15H16ClNO/c1-17(2)14-9-5-12(6-10-14)15(18)11-3-7-13(16)8-4-11/h3-10,15,18H,1-2H3
InChI key:InChIKey=YWMBKLFJNVWHFF-UHFFFAOYSA-N
SMILES:C(O)(C1=CC=C(N(C)C)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- 4-Chloro-α-[4-(dimethylamino)phenyl]benzenemethanol
- (4-Chlorophenyl)[4-(dimethylamino)phenyl]methanol
- Benzenemethanol, 4-chloro-α-[4-(dimethylamino)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.