CAS 844683-49-4
:3,5-Dichloro-α-(3-chlorophenyl)benzenemethanol
Description:
3,5-Dichloro-α-(3-chlorophenyl)benzenemethanol, identified by its CAS number 844683-49-4, is a chemical compound characterized by its complex aromatic structure. It features multiple chlorine substituents, which significantly influence its chemical properties, including increased lipophilicity and potential biological activity. The presence of the benzenemethanol moiety suggests that it may exhibit alcohol-like properties, potentially allowing for hydrogen bonding interactions. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential as a synthetic intermediate or as a candidate for biological activity. Its chlorinated structure may also impart unique reactivity patterns, making it suitable for further chemical modifications. Safety and handling considerations are essential, as chlorinated compounds can pose environmental and health risks. Overall, 3,5-Dichloro-α-(3-chlorophenyl)benzenemethanol represents a noteworthy example of chlorinated aromatic compounds with diverse applications in research and industry.
Formula:C13H9Cl3O
InChI:InChI=1S/C13H9Cl3O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13,17H
InChI key:InChIKey=ZMTMMOKKPHMKDQ-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(Cl)=CC=C2
Synonyms:- Benzenemethanol, 3,5-dichloro-α-(3-chlorophenyl)-
- 3,5-Dichloro-α-(3-chlorophenyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.