CAS 844683-51-8

α-(3-Chlorophenyl)-3,5-difluorobenzenemethanol

Description:

α-(3-Chlorophenyl)-3,5-difluorobenzenemethanol, with the CAS number 844683-51-8, is an organic compound characterized by its complex aromatic structure. It features a benzene ring substituted with both chlorine and fluorine atoms, which contribute to its unique chemical properties. The presence of the hydroxymethyl group (-CH2OH) indicates that it is an alcohol, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The chlorophenyl group introduces additional reactivity and potential for electrophilic substitution reactions. The difluorobenzene moiety suggests that the compound may exhibit interesting electronic properties due to the electronegative fluorine atoms, which can influence the compound's reactivity and stability. This compound may be of interest in pharmaceutical research or material science due to its potential biological activity and unique structural features. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.

Formula: C₁₃H₉ClF₂O

InChI: InChI=1S/C13H9ClF2O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13,17H

InChI key: InChIKey=QMYZVECPIZFBQW-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(F)=CC(F)=C1)C2=CC(Cl)=CC=C2

3-Chloro-3',5'-difluorobenzhydrol

CAS: 844683-51-8

3-Chloro-3',5'-difluorobenzhydrol

Purity: 97%

Molecular weight: 254.66g/mol

Ref: 54-PC2580