CAS 844683-53-0

Benzenemethanol, 3-chloro-α-[4-(dimethylamino)phenyl]-

Description:

Benzenemethanol, 3-chloro-α-[4-(dimethylamino)phenyl]- is an organic compound characterized by its complex structure, which includes a benzene ring, a chloromethyl group, and a dimethylamino group. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. The presence of the dimethylamino group enhances its basicity and may influence its solubility in polar solvents. The chloro substituent can also affect the compound's reactivity, making it a potential candidate for further chemical modifications. In terms of applications, compounds with similar structures are often explored in pharmaceuticals, dyes, and agrochemicals due to their biological activity and ability to interact with various biological targets. Safety and handling considerations are important, as halogenated compounds can pose health risks, and appropriate precautions should be taken when working with this substance. Overall, the unique combination of functional groups in this compound contributes to its potential utility in various chemical and industrial applications.

Formula: C₁₅H₁₆ClNO

InChI: InChI=1S/C15H16ClNO/c1-17(2)14-8-6-11(7-9-14)15(18)12-4-3-5-13(16)10-12/h3-10,15,18H,1-2H3

InChI key: InChIKey=CQDHNJUPOKRHNV-UHFFFAOYSA-N

SMILES: C(O)(C1=CC=C(N(C)C)C=C1)C2=CC(Cl)=CC=C2

Synonyms:

• Benzenemethanol, 3-chloro-α-[4-(dimethylamino)phenyl]-