CAS 844683-55-2

Benzenemethanol, 3-chloro-α-(4-ethylphenyl)-

Description:

Benzenemethanol, 3-chloro-α-(4-ethylphenyl)-, also known by its CAS number 844683-55-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a chloro group at the 3-position and an ethylphenyl group at the α-position relative to the benzylic alcohol. This compound exhibits properties typical of aromatic alcohols, including moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The chloro substituent can influence its reactivity and polarity, making it a candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the ethylphenyl group contributes to the compound's hydrophobic characteristics, which may affect its interactions in biological systems or industrial applications. Overall, this compound's unique structure allows for diverse applications in fields such as pharmaceuticals, agrochemicals, and materials science, where its specific reactivity and solubility properties can be advantageous.

Formula: C₁₅H₁₅ClO

InChI: InChI=1S/C15H15ClO/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(16)10-13/h3-10,15,17H,2H2,1H3

InChI key: InChIKey=UKJJJZQAHBUCAA-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(Cl)=CC=C1)C2=CC=C(CC)C=C2

Synonyms:

• Benzenemethanol, 3-chloro-α-(4-ethylphenyl)-