CAS 844683-57-4
:3-Chloro-α-(3-methoxyphenyl)benzenemethanol
Description:
3-Chloro-α-(3-methoxyphenyl)benzenemethanol, with the CAS number 844683-57-4, is an organic compound characterized by its complex structure, which includes a chlorinated aromatic ring and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with aromatic alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The chlorine atom introduces additional polarity and can influence the compound's reactivity and interaction with biological systems. The methoxy group contributes to the compound's overall hydrophobic character while also providing sites for potential hydrogen bonding. As a result, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and functional group transformations. Overall, the unique combination of functional groups in 3-Chloro-α-(3-methoxyphenyl)benzenemethanol suggests potential applications in various chemical and pharmaceutical contexts.
Formula:C14H13ClO2
InChI:InChI=1S/C14H13ClO2/c1-17-13-7-3-5-11(9-13)14(16)10-4-2-6-12(15)8-10/h2-9,14,16H,1H3
InChI key:InChIKey=OHGNGRZLJIHLIA-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=CC=C1)C2=CC(Cl)=CC=C2
Synonyms:- 3-Chloro-α-(3-methoxyphenyl)benzenemethanol
- Benzenemethanol, 3-chloro-α-(3-methoxyphenyl)-
- 3-CHLORO-3'-METHOXYBENZHYDROL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.