CAS 844683-58-5
:Benzenemethanol, 3-chloro-α-[4-(methylthio)phenyl]-
Description:
Benzenemethanol, 3-chloro-α-[4-(methylthio)phenyl]- is an organic compound characterized by its complex structure, which includes a benzene ring, a chloromethyl group, and a methylthio substituent. This compound typically exhibits properties common to aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. The presence of the chlorine atom introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The methylthio group enhances the compound's potential for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on environmental conditions and the presence of impurities. Overall, this compound represents a unique combination of functional groups that may impart specific chemical behaviors and applications.
Formula:C14H13ClOS
InChI:InChI=1S/C14H13ClOS/c1-17-13-7-5-10(6-8-13)14(16)11-3-2-4-12(15)9-11/h2-9,14,16H,1H3
InChI key:InChIKey=QRJKTRZMFCXWEH-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(Cl)=CC=C1)C2=CC=C(SC)C=C2
Synonyms:- Benzenemethanol, 3-chloro-α-[4-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.