CAS 844683-64-3

3,5-Dichloro-α-(3-fluorophenyl)benzenemethanol

Description:

3,5-Dichloro-α-(3-fluorophenyl)benzenemethanol is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with chlorine and fluorine atoms, as well as a hydroxymethyl group. The presence of two chlorine atoms at the 3 and 5 positions of the benzene ring contributes to its reactivity and potential biological activity. The α-(3-fluorophenyl) substituent indicates that a fluorinated phenyl group is attached to the carbon adjacent to the hydroxymethyl group, which can influence the compound's lipophilicity and interaction with biological targets. This compound may exhibit properties typical of halogenated aromatic compounds, such as increased stability and potential for bioactivity. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would depend on further empirical studies. As with many halogenated compounds, safety and environmental considerations are essential, given the potential for persistence and bioaccumulation.

Formula: C₁₃H₉Cl₂FO

InChI: InChI=1S/C13H9Cl2FO/c14-10-4-9(5-11(15)7-10)13(17)8-2-1-3-12(16)6-8/h1-7,13,17H

InChI key: InChIKey=JSJGUBLWNOMVID-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(F)=CC=C2

Synonyms:

• 3,5-Dichloro-α-(3-fluorophenyl)benzenemethanol
• Benzenemethanol, 3,5-dichloro-α-(3-fluorophenyl)-