CAS 844683-67-6
:α-(3-Fluorophenyl)-3,4-dimethoxybenzenemethanol
Description:
α-(3-Fluorophenyl)-3,4-dimethoxybenzenemethanol, with the CAS number 844683-67-6, is an organic compound characterized by its complex aromatic structure. It features a fluorophenyl group, which contributes to its electronic properties and potential reactivity. The presence of methoxy groups (–OCH3) on the benzene ring enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature and substituents, which can affect its pharmacokinetics if it is studied for medicinal purposes. The hydroxyl group (–OH) in the benzenemethanol portion can participate in hydrogen bonding, impacting its interactions with biological targets. Additionally, the fluorine atom can enhance the compound's metabolic stability and alter its binding affinity to receptors or enzymes. Overall, the unique combination of functional groups in α-(3-Fluorophenyl)-3,4-dimethoxybenzenemethanol suggests potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis.
Formula:C15H15FO3
InChI:InChI=1S/C15H15FO3/c1-18-13-7-6-11(9-14(13)19-2)15(17)10-4-3-5-12(16)8-10/h3-9,15,17H,1-2H3
InChI key:InChIKey=YCCJFUWUBOQTHK-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=C(OC)C=C1)C2=CC(F)=CC=C2
Synonyms:- α-(3-Fluorophenyl)-3,4-dimethoxybenzenemethanol
- Benzenemethanol, α-(3-fluorophenyl)-3,4-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.