CAS 844683-70-1
:Benzenemethanol, α-(4-ethylphenyl)-3-fluoro-
Description:
Benzenemethanol, α-(4-ethylphenyl)-3-fluoro- is an organic compound characterized by its structure, which includes a benzene ring, a methanol group, and a fluorine atom attached to the aromatic system. The presence of the ethyl group at the para position relative to the hydroxymethyl group contributes to its hydrophobic characteristics, while the fluorine atom introduces unique electronic properties, potentially enhancing its reactivity and influencing its interactions with biological systems. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of compounds with specific biological activities. Additionally, the presence of the fluorine atom may impart increased stability and lipophilicity, making it a candidate for further study in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H15FO
InChI:InChI=1S/C15H15FO/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(16)10-13/h3-10,15,17H,2H2,1H3
InChI key:InChIKey=WEGROKZPWGMYSN-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(F)=CC=C1)C2=CC=C(CC)C=C2
Synonyms:- (4-Ethylphenyl)-(3-fluorophenyl)methanol
- Benzenemethanol, α-(4-ethylphenyl)-3-fluoro-
- 4-ETHYL-3'-FLUOROBENZHYDROL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.