CymitQuimica logo

CAS 844683-72-3

:

3-Fluoro-α-[4-(methylthio)phenyl]benzenemethanol

Description:
3-Fluoro-α-[4-(methylthio)phenyl]benzenemethanol is an organic compound characterized by its complex structure, which includes a fluorine atom, a methylthio group, and a benzenemethanol moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methylthio group can contribute to the compound's electronic properties and steric effects, potentially affecting its reactivity and interactions with biological targets. The benzenemethanol structure indicates that the compound has a hydroxyl (-OH) functional group, which can participate in hydrogen bonding, influencing solubility and reactivity. This compound may exhibit unique pharmacological properties, making it a candidate for further research in drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would require experimental determination or detailed literature references for precise values. Overall, the combination of these functional groups suggests potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H13FOS
InChI:InChI=1S/C14H13FOS/c1-17-13-7-5-10(6-8-13)14(16)11-3-2-4-12(15)9-11/h2-9,14,16H,1H3
InChI key:InChIKey=GDUKTRLMPKAIHC-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(F)=CC=C1)C2=CC=C(SC)C=C2
Synonyms:
  • 3-Fluoro-α-[4-(methylthio)phenyl]benzenemethanol
  • (3-Fluorophenyl)(4-methylsulfanylphenyl)methanol
  • Benzenemethanol, 3-fluoro-α-[4-(methylthio)phenyl]-
  • 3-Fluoro-4′-(methylthio)benzhydrol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.