CAS 844683-76-7

3,5-Dichloro-α-(4-fluorophenyl)benzenemethanol

Description:

3,5-Dichloro-α-(4-fluorophenyl)benzenemethanol, identified by its CAS number 844683-76-7, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with chlorine and fluorine atoms. This compound features two chlorine atoms located at the 3 and 5 positions of the benzene ring, while a fluorophenyl group is attached to the alpha position of the benzenemethanol moiety. The presence of these halogen substituents often influences the compound's reactivity, solubility, and biological activity. Typically, such compounds may exhibit properties that make them of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The hydroxyl (-OH) group in the benzenemethanol structure can also contribute to hydrogen bonding, affecting the compound's interactions in various chemical environments. Overall, the unique combination of halogen substituents and functional groups in 3,5-Dichloro-α-(4-fluorophenyl)benzenemethanol suggests potential applications in medicinal chemistry and materials science.

Formula: C₁₃H₉Cl₂FO

InChI: InChI=1S/C13H9Cl2FO/c14-10-5-9(6-11(15)7-10)13(17)8-1-3-12(16)4-2-8/h1-7,13,17H

InChI key: InChIKey=HZQMTMDGGMCBDI-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC=C(F)C=C2

Synonyms:

• 3,5-Dichloro-α-(4-fluorophenyl)benzenemethanol
• Benzenemethanol, 3,5-dichloro-α-(4-fluorophenyl)-