CymitQuimica logo

CAS 844694-85-5

:

1,1-dibenzyl-4-[(5,6-dimethoxy-1-oxo-2,3-dihydro-1H-inden-2-yl)methyl]piperidinium bromide

Description:
1,1-Dibenzyl-4-[(5,6-dimethoxy-1-oxo-2,3-dihydro-1H-inden-2-yl)methyl]piperidinium bromide is a quaternary ammonium compound characterized by its complex structure, which includes a piperidine ring substituted with dibenzyl and a functionalized indene moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as high solubility in polar solvents and potential surfactant behavior. The presence of methoxy groups suggests that it may have enhanced lipophilicity and could participate in various chemical reactions, including nucleophilic substitutions. Its bromide counterion indicates that it may have ionic characteristics, contributing to its solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Overall, its unique structural features and functional groups suggest potential applications in drug development and as a chemical intermediate in organic synthesis.
Formula:C31H36BrNO3
InChI:InChI=1/C31H36NO3.BrH/c1-34-29-19-26-18-27(31(33)28(26)20-30(29)35-2)17-23-13-15-32(16-14-23,21-24-9-5-3-6-10-24)22-25-11-7-4-8-12-25;/h3-12,19-20,23,27H,13-18,21-22H2,1-2H3;1H/q+1;/p-1
InChI key:SSZOWVQOUFMSCQ-UHFFFAOYSA-M
SMILES:COC1=C(C=C2C(=C1)CC(C2=O)CC3CC[N+](CC3)(CC4=CC=CC=C4)CC5=CC=CC=C5)OC.[Br-]
Found 11 products.