CymitQuimica logo

CAS 84472-86-6

:

3'-amino-2',3'-dideoxyuridine

Description:
3'-Amino-2',3'-dideoxyuridine (CAS 84472-86-6) is a nucleoside analog that plays a significant role in biochemical research and pharmaceutical applications. It is characterized by the presence of an amino group at the 3' position and lacks the hydroxyl groups typically found in the ribose sugar of standard nucleosides, which contributes to its dideoxy nature. This structural modification enhances its stability and resistance to nucleases, making it a valuable tool in molecular biology, particularly in studies involving DNA synthesis and antiviral drug development. The compound exhibits potential antiviral activity, particularly against certain viruses, by interfering with viral replication processes. Additionally, its unique structure allows it to be incorporated into nucleic acids, which can lead to chain termination during DNA synthesis. Overall, 3'-amino-2',3'-dideoxyuridine is an important compound in the field of medicinal chemistry and virology, providing insights into nucleic acid interactions and therapeutic strategies.
Formula:C9H13N3O4
InChI:InChI=1/C9H13N3O4/c10-5-3-8(16-6(5)4-13)12-2-1-7(14)11-9(12)15/h1-2,5-6,8,13H,3-4,10H2,(H,11,14,15)/t5-,6+,8+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.