CymitQuimica logo

CAS 84473-64-3

:

2-Pyrazinecarbonyl chloride, hydrochloride (1:1)

Description:
2-Pyrazinecarbonyl chloride, hydrochloride (1:1) is a chemical compound characterized by its pyrazine ring structure, which contributes to its reactivity and potential applications in organic synthesis. As a carbonyl chloride derivative, it features a carbonyl group (C=O) adjacent to a chloride (Cl) atom, making it a useful reagent for acylation reactions. The hydrochloride form indicates that the compound exists as a salt, enhancing its solubility in polar solvents, which is beneficial for various laboratory applications. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals, where the pyrazine moiety can impart biological activity. It is important to handle this substance with care, as carbonyl chlorides can be reactive and potentially hazardous, requiring appropriate safety measures during use. Additionally, its properties may include a specific melting point and solubility characteristics, which are essential for its practical applications in chemical reactions and formulations.
Formula:C5H3ClN2O·ClH
InChI:InChI=1S/C5H3ClN2O.ClH/c6-5(9)4-3-7-1-2-8-4;/h1-3H;1H
InChI key:InChIKey=ZOFWDSYSIJNFMU-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C=NC=CN1.Cl
Synonyms:
  • Pyrazinecarbonyl chloride, monohydrochloride
  • 2-Pyrazinecarbonyl chloride, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.