CAS 84476-99-3
:2,5-Difluoropyridine
Description:
2,5-Difluoropyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two fluorine atoms at the 2 and 5 positions. Its molecular formula is C5H4F2N, and it features a nitrogen atom within the six-membered ring, contributing to its basicity and reactivity. The presence of fluorine atoms enhances its polarity and can influence its solubility in various solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and has a distinctive odor. 2,5-Difluoropyridine is used in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds, owing to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its properties, such as boiling point, melting point, and density, are influenced by the fluorine substituents, which can also affect its reactivity and interaction with biological systems. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H3F2N
InChI:InChI=1/C5H3F2N/c6-4-1-2-5(7)8-3-4/h1-3H
SMILES:c1cc(F)ncc1F
Synonyms:- 2,5-Difluorpyridin
- Pyridine, 2,5-difluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Difluoropyridine
CAS:Formula:C5H3F2NPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:115.082,5-Difluoropyridine
CAS:2,5-DifluoropyridineFormula:C5H3F2NPurity:96%Color and Shape: colourless to light yellow liquidMolecular weight:115.08g/mol2,5-Difluoropyridine
CAS:2,5-Difluoropyridine is a ligand that is used in the synthesis of pharmaceuticals and other organic compounds. 2,5-Difluoropyridine is typically activated by a metal ion (e.g., palladium) to form an organometallic complex. The orientation of substituents on the difluoropyridine ring can affect its reactivity and selectivity. For example, chlorine atoms interact with the electrophilic carbon atom in the ring and orientations with electron withdrawing groups are more reactive than those with electron donating groups. 2,5-Difluoropyridine can be used as a cross-coupling reagent for Grignard reactions and nucleophilic substitution reactions. It also has been shown to inhibit human erythrocyte pyruvate kinase activity in vitro and may be useful for the treatment of diabetic complications such as neuropathy or retinopathy.Formula:C5H3F2NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:115.08 g/mol




