CAS 84477-04-3
:2,3,4-Trifluoropyridine
Description:
2,3,4-Trifluoropyridine is a fluorinated heterocyclic compound characterized by a pyridine ring with three fluorine substituents at the 2, 3, and 4 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits a distinct aromatic odor and is known for its relatively high stability due to the presence of the aromatic ring. The trifluoromethyl groups enhance its reactivity, making it useful in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries. 2,3,4-Trifluoropyridine is polar and can engage in hydrogen bonding, which influences its solubility in polar solvents. Its unique electronic properties, stemming from the electronegative fluorine atoms, can affect the compound's acidity and basicity, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H2F3N
InChI:InChI=1/C5H2F3N/c6-3-1-2-9-5(8)4(3)7/h1-2H
SMILES:c1cnc(c(c1F)F)F
Synonyms:- Pyridine, 2,3,4-Trifluoro-
- Trifluoroperazine
- 2,3,4-Trifluoropyridine
- 2,3,4-Trifluoropyridine ISO 9001:2015 REACH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.