CAS 84477-72-5
:2,2-dimethylpiperazine
Description:
2,2-Dimethylpiperazine is a cyclic organic compound characterized by its piperazine structure, which consists of a six-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 2-position of the ring contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in water and various organic solvents, making it versatile for different applications. 2,2-Dimethylpiperazine exhibits basic properties due to the nitrogen atoms, allowing it to act as a nucleophile in chemical reactions. It is often used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Additionally, it can serve as a curing agent in epoxy resins and as a stabilizer in polymer formulations. Safety considerations include handling it with care, as it can be irritating to the skin and eyes, and appropriate protective measures should be taken during its use.
Formula:C6H14N2
InChI:InChI=1/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3
SMILES:CC1(C)CNCCN1
Synonyms:- 2,3-Dimethylpiperazin
- Piperazine, 2,3-Dimethyl-
- 2,3-Dimethylpiperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA0032X1
1g38.00€5g93.00€10g139.00€1kgTo inquire25g227.00€100gTo inquire250gTo inquire500gTo inquire250mg26.00€2,2-Dimethylpiperazine
CAS:Controlled Product<p>Applications 2,2-Dimethylpiperazine is a chemical reagent used in the preparation of non-covalent NAAA inhibitors used as a protective agent for the development of multiple sclerosis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Migliore, M. et al.: Angew. Chem. Int. Ed., 55, 11193 (2016);<br></p>Formula:C6H14N2Color and Shape:NeatMolecular weight:114.19
