CAS 84478-52-4
:Flumipropyn
Description:
Flumipropyn is a chemical compound classified as a herbicide, primarily used in agricultural applications for weed control. It belongs to the class of compounds known as propylenes, which are characterized by their ability to inhibit specific biochemical pathways in plants. Flumipropyn acts by interfering with the synthesis of certain essential plant hormones, leading to the disruption of growth processes in target weeds. This selective action allows it to effectively manage unwanted vegetation while minimizing harm to desirable crops. The compound is typically applied in pre-emergent or post-emergent formulations, depending on the target species and the timing of application. In terms of physical properties, Flumipropyn is generally a colorless to pale yellow liquid with low volatility and moderate solubility in organic solvents. Safety data indicates that, like many herbicides, it should be handled with care, following appropriate safety guidelines to minimize environmental impact and human exposure. Overall, Flumipropyn represents a valuable tool in modern agricultural practices for effective weed management.
Formula:C18H15ClFNO3
InChI:InChI=1S/C18H15ClFNO3/c1-3-10(2)24-16-9-15(14(20)8-13(16)19)21-17(22)11-6-4-5-7-12(11)18(21)23/h1,8-10H,4-7H2,2H3
InChI key:InChIKey=ONNQFZOZHDEENE-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C2=C1CCCC2)C3=CC(OC(C#C)C)=C(Cl)C=C3F
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-(4-chloro-2-fluoro-5-((1-methyl-2-propynyl)oxy)phenyl)-4,5,6,7-tetrahydro-
- 1H-isoindole-1,3(2H)-dione, 2-[4-chloro-2-fluoro-5-[(1-methyl-2-propyn-1-yl)oxy]phenyl]-4,5,6,7-tetrahydro-
- 2-[4-Chloro-2-fluoro-5-[(1-methyl-2-propyn-1-yl)oxy]phenyl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione
- 2-[5-(3-Butyn-2-yloxy)-4-chloro-2-fluorophenyl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione
- 2-[5-(But-3-in-2-yloxy)-4-chlor-2-fluorphenyl]-4,5,6,7-tetrahydro-1H-isoindol-1,3(2H)-dion
- 84478-52-4
- Flumipropyn
- N-(4-Chloro-2-fluoro-5-((1-methyl-2-propynyl)oxy)phenyl)-3,4,5,6-tetrahydrophthalimide
- S 23121
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.