CymitQuimica logo

CAS 844817-70-5

:

α-Cyclopropyl-2-fluorobenzenemethanamine

Description:
α-Cyclopropyl-2-fluorobenzenemethanamine, with the CAS number 844817-70-5, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, attached to a benzene ring that has a fluorine substituent at the para position relative to the amine group. This compound is classified as an aromatic amine due to the presence of the amine functional group (-NH2) linked to a benzene ring. The fluorine atom introduces electronegative characteristics, potentially influencing the compound's reactivity and interaction with biological systems. The cyclopropyl moiety can impart strain and unique steric effects, which may affect the compound's pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific properties, such as solubility, melting point, and reactivity, would depend on the compound's interactions with solvents and other chemical species, making it a subject of interest in both synthetic and applied chemistry.
Formula:C10H12FN
InChI:InChI=1S/C10H12FN/c11-9-4-2-1-3-8(9)10(12)7-5-6-7/h1-4,7,10H,5-6,12H2
InChI key:InChIKey=ZGPDSOISFOQZLZ-UHFFFAOYSA-N
SMILES:C(N)(C1CC1)C2=C(F)C=CC=C2
Synonyms:
  • Benzenemethanamine, α-cyclopropyl-2-fluoro-
  • α-Cyclopropyl-2-fluorobenzenemethanamine
Found 3 products.