CAS 844818-52-6

5-(4-Fluorophenyl)-2-oxazolemethanol

Description:

5-(4-Fluorophenyl)-2-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of the 4-fluorophenyl group indicates that there is a fluorine atom substituted on a phenyl ring, which can influence the compound's electronic properties and reactivity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group (-CH2OH) attached to the oxazole ring may contribute to its reactivity and ability to form hydrogen bonds, which can be significant in biological interactions. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability. Overall, 5-(4-Fluorophenyl)-2-oxazolemethanol is a compound that may be explored for its potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₀H₈FNO₂

InChI: InChI=1S/C10H8FNO2/c11-8-3-1-7(2-4-8)9-5-12-10(6-13)14-9/h1-5,13H,6H2

InChI key: InChIKey=YAWZQZYIGAJDAT-UHFFFAOYSA-N

SMILES: C(O)C=1OC(=CN1)C2=CC=C(F)C=C2

Synonyms:

• [5-(4-Fluorophenyl)-1,3-oxazol-2-yl]methanol
• 5-(4-Fluorophenyl)-2-oxazolemethanol
• 2-Oxazolemethanol, 5-(4-fluorophenyl)-
• [5-(4-Fluorophenyl)-1,3-oxazole-2-yl]methanol

[5-(4-Fluorophenyl)-1,3-oxazol-2-yl]methanol

CAS: 844818-52-6

Versatile small molecule scaffold

Formula: C₁₀H₈FNO₂

Purity: Min. 95%

Molecular weight: 193.17 g/mol

Ref: 3D-UIB81852