CAS 844856-31-1
:3,5-Difluoro-α-(4-fluorophenyl)benzenemethanol
Description:
3,5-Difluoro-α-(4-fluorophenyl)benzenemethanol, with the CAS number 844856-31-1, is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with multiple fluorine atoms and a hydroxymethyl group. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound may exhibit interesting properties such as increased stability and altered solubility compared to its non-fluorinated counterparts. The hydroxymethyl group suggests potential for hydrogen bonding, which can affect its interactions in biological systems or with other chemical entities. Additionally, the specific arrangement of the fluorine substituents can lead to unique electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Overall, the characteristics of this compound make it a subject of interest for further research, particularly in the development of pharmaceuticals or advanced materials.
Formula:C13H9F3O
InChI:InChI=1S/C13H9F3O/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13,17H
InChI key:InChIKey=LQWBSFQCDFKNBG-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(F)=CC(F)=C1)C2=CC=C(F)C=C2
Synonyms:- 3,5-Difluoro-α-(4-fluorophenyl)benzenemethanol
- Benzenemethanol, 3,5-difluoro-α-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.