CAS 844856-32-2
:α-(4-Fluorophenyl)-3,4-dimethoxybenzenemethanol
Description:
α-(4-Fluorophenyl)-3,4-dimethoxybenzenemethanol, with the CAS number 844856-32-2, is an organic compound characterized by its complex aromatic structure. It features a fluorophenyl group, which contributes to its electronic properties and potential reactivity. The presence of methoxy groups (–OCH3) on the benzene ring enhances its solubility in organic solvents and may influence its biological activity. The hydroxyl group (–OH) in the benzenemethanol portion provides the compound with potential hydrogen bonding capabilities, which can affect its interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and its stability can be influenced by environmental factors such as temperature and pH. Overall, α-(4-Fluorophenyl)-3,4-dimethoxybenzenemethanol is a notable compound in the realm of organic chemistry, with potential applications in drug development and materials science.
Formula:C15H15FO3
InChI:InChI=1S/C15H15FO3/c1-18-13-8-5-11(9-14(13)19-2)15(17)10-3-6-12(16)7-4-10/h3-9,15,17H,1-2H3
InChI key:InChIKey=YVYXGDYISKEXOY-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=C(OC)C=C1)C2=CC=C(F)C=C2
Synonyms:- α-(4-Fluorophenyl)-3,4-dimethoxybenzenemethanol
- Benzenemethanol, α-(4-fluorophenyl)-3,4-dimethoxy-
- 4-FLUORO-3',4'-DIMETHOXYBENZHYDROL
- (3,4-Dimethoxyphenyl)(4-fluorophenyl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.