CAS 844856-37-7

3-Fluoro-α-(3-methoxyphenyl)benzenemethanol

Description:

3-Fluoro-α-(3-methoxyphenyl)benzenemethanol, with the CAS number 844856-37-7, is an organic compound characterized by the presence of a fluorine atom and a methoxyphenyl group attached to a benzenemethanol framework. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its solubility in polar solvents. The methoxy group contributes to the compound's overall electronic properties, often acting as an electron-donating group, which can affect its interaction with biological targets or other chemical species. Additionally, the hydroxyl group in the benzenemethanol structure can participate in hydrogen bonding, influencing its physical properties such as boiling and melting points, as well as its solubility in various solvents. Overall, this compound may have applications in medicinal chemistry or materials science, depending on its specific biological activity and chemical behavior.

Formula: C₁₄H₁₃FO₂

InChI: InChI=1S/C14H13FO2/c1-17-13-7-3-5-11(9-13)14(16)10-4-2-6-12(15)8-10/h2-9,14,16H,1H3

InChI key: InChIKey=FGEAOSYXTCGVGV-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(OC)=CC=C1)C2=CC(F)=CC=C2

Synonyms:

• 3-Fluoro-α-(3-methoxyphenyl)benzenemethanol
• Benzenemethanol, 3-fluoro-α-(3-methoxyphenyl)-
• (3-Fluorophenyl)(3-methoxyphenyl)methanol
• 3-Fluoro-3′-methoxybenzhydrol