CAS 844856-38-8
:3,5-Dichloro-3′-fluoro-1,1′-biphenyl
Description:
3,5-Dichloro-3′-fluoro-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 3 and 5 positions on one phenyl ring and a fluorine atom at the 3' position on the adjacent ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in various fields, including materials science and pharmaceuticals, due to the presence of halogen substituents that can influence reactivity and stability. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,5-Dichloro-3′-fluoro-1,1′-biphenyl is a notable compound for its structural features and potential applications in chemical research.
Formula:C12H7Cl2F
InChI:InChI=1S/C12H7Cl2F/c13-10-4-9(5-11(14)7-10)8-2-1-3-12(15)6-8/h1-7H
InChI key:InChIKey=NFFYHBLKVPVGNO-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(Cl)C1)C2=CC(F)=CC=C2
Synonyms:- 1,3-Dichloro-5-(3-fluorophenyl)benzene
- 3'-Fluoro-3,5-dichlorobiphenyl
- 3,5-Dichloro-3'-fluorobiphenyl
- 3,5-Dichloro-3′-fluoro-1,1′-biphenyl
- 1,1′-Biphenyl, 3,5-dichloro-3′-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.