CAS 844856-48-0
:N,N-Dimethyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-amine
Description:
N,N-Dimethyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-amine is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethyl group (-CF3) at the 3' position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The dimethylamino group (-N(CH3)2) at the 4-position contributes to its basicity and can participate in hydrogen bonding, making it a potential candidate for various applications in pharmaceuticals and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group can also impart unique electronic properties, making it of interest in the development of agrochemicals and specialty chemicals. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C15H14F3N
InChI:InChI=1S/C15H14F3N/c1-19(2)14-8-6-11(7-9-14)12-4-3-5-13(10-12)15(16,17)18/h3-10H,1-2H3
InChI key:InChIKey=SOQSNCQDKHZSFE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(N(C)C)C=C2
Synonyms:- N,N-Dimethyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-amine
- [1,1′-Biphenyl]-4-amine, N,N-dimethyl-3′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.