CAS 844856-50-4
:4′-(Methylthio)-3-(trifluoromethyl)-1,1′-biphenyl
Description:
4′-(Methylthio)-3-(trifluoromethyl)-1,1′-biphenyl, identified by its CAS number 844856-50-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methylthio group (-S-CH3) at the para position of one phenyl ring and a trifluoromethyl group (-CF3) at the meta position of the other ring significantly influences its chemical properties. This compound is likely to exhibit hydrophobic characteristics due to the large trifluoromethyl group, which can enhance its lipophilicity. Additionally, the methylthio group may impart some nucleophilic properties, making it reactive in certain chemical environments. The trifluoromethyl group is known for its electron-withdrawing effects, which can affect the compound's reactivity and stability. Overall, this compound may find applications in various fields, including pharmaceuticals and materials science, due to its unique electronic and steric properties.
Formula:C14H11F3S
InChI:InChI=1S/C14H11F3S/c1-18-13-7-5-10(6-8-13)11-3-2-4-12(9-11)14(15,16)17/h2-9H,1H3
InChI key:InChIKey=QFEWFBYUNMZRGE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(SC)C=C2
Synonyms:- 4′-(Methylthio)-3-(trifluoromethyl)-1,1′-biphenyl
- 1,1′-Biphenyl, 4′-(methylthio)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.