CAS 84487-06-9

6-Amino-5-nitro-2-pyridinecarboxylic acid

Description:

6-Amino-5-nitro-2-pyridinecarboxylic acid, with the CAS number 84487-06-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a nitro group (-NO2) attached to the pyridine ring, as well as a carboxylic acid group (-COOH) at the 2-position. The presence of these functional groups contributes to its acidic properties and potential reactivity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity and role as a building block in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other substances.

Formula: C₆H₅N₃O₄

InChI: InChI=1S/C6H5N3O4/c7-5-4(9(12)13)2-1-3(8-5)6(10)11/h1-2H,(H2,7,8)(H,10,11)

InChI key: InChIKey=HVYVJNJMZVUYDH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(N)C(N(=O)=O)=CC1

Synonyms:

• 6-Amino-5-nitropicolinic acid
• 2-Pyridinecarboxylic acid, 6-amino-5-nitro-
• 6-Amino-5-nitro-2-pyridinecarboxylic acid

6-Amino-5-nitropyridine-2-carboxylic acid

CAS: 84487-06-9

6-Amino-5-nitropyridine-2-carboxylic acid is a hydroxyethyl derivative of a pyridine compound with the chemical formula C6H7NO3. This compound has an x-ray crystallographic structure that was elucidated by x-ray crystallographic studies. The crystal contains two molecules and the molecular weight is 227.37 g/mol. The compound has substituents at the benzene ring, the guanidine group, and the carboxylic group. 6-Amino-5-nitropyridine-2-carboxylic acid also has a neuraminidase inhibitory activity, which can be demonstrated in vitro using influenza virus neuraminidase as a model enzyme.

Formula: C₆H₅N₃O₄

Purity: Min. 95%

Molecular weight: 183.12 g/mol

Ref: 3D-JDA48706