CAS 84487-08-1

4-methoxy-3-nitropyridin-2-amine

Description:

4-Methoxy-3-nitropyridin-2-amine is an organic compound characterized by its pyridine ring, which is substituted with a methoxy group and a nitro group. The presence of the methoxy group (-OCH3) typically enhances the compound's solubility in organic solvents and can influence its reactivity and biological activity. The nitro group (-NO2) is known for its electron-withdrawing properties, which can affect the compound's acidity and reactivity in electrophilic substitution reactions. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific functional groups attached to the pyridine ring. Overall, 4-methoxy-3-nitropyridin-2-amine is a versatile compound with potential applications in various fields, including drug development and organic synthesis.

Formula: C₆H₇N₃O₃

InChI: InChI=1/C6H7N3O3/c1-12-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3,(H2,7,8)

SMILES: COc1cc[nH]c(=N)c1N(=O)=O

Synonyms:

• 2-Pyridinamine, 4-Methoxy-3-Nitro-

4-Methoxy-3-nitro-2-pyridinamine

CAS: 84487-08-1

Formula: C₆H₇N₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.1381

Ref: IN-DA008HXJ

2-Amino-4-methoxy-3-nitropyridine

CAS: 84487-08-1

2-Amino-4-methoxy-3-nitropyridine

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.14g/mol

Ref: 54-OR3138

4-METHOXY-3-NITROPYRIDIN-2-AMINE

CAS: 84487-08-1

Purity: 98%

Molecular weight: 169.1399994

Ref: 10-F799951

2-Amino-4-methoxy-3-nitropyridine

Controlled Product

CAS: 84487-08-1

Applications 2-Amino-4-methoxy-3-nitropyridine (cas# 84487-08-1) is a compound useful in organic synthesis.

Formula: C₆H₇N₃O₃

Color and Shape: Neat

Molecular weight: 169.14

Ref: TR-A611947