CymitQuimica logo

CAS 84487-10-5

:

4-Bromo-3-nitro-2-pyridinamine

Description:
4-Bromo-3-nitro-2-pyridinamine, with the CAS number 84487-10-5, is an organic compound that features a pyridine ring substituted with both a bromine atom and a nitro group, as well as an amino group. This compound typically appears as a solid and is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The bromine and nitro substituents can influence the compound's electronic properties, making it a candidate for further chemical modifications or reactions. Additionally, the amino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents. The presence of these functional groups suggests that 4-Bromo-3-nitro-2-pyridinamine may exhibit biological activity, making it of interest for research in medicinal chemistry. As with many nitrogen-containing heterocycles, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C5H4BrN3O2
InChI:InChI=1S/C5H4BrN3O2/c6-3-1-2-8-5(7)4(3)9(10)11/h1-2H,(H2,7,8)
InChI key:InChIKey=WCHFLLNYYVWJEI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(Br)=CC=NC1N
Synonyms:
  • 2-Pyridinamine, 4-bromo-3-nitro-
  • 4-Bromo-3-Nitropyridin-2-Amine
  • 4-Bromo-3-nitro-2-pyridinamine
  • 2-Amino-4-bromo-3-nitropyridine
Found 6 products.