CAS 84487-13-8
:4-Amino-5-nitro-2-pyridinecarboxylic acid
Description:
4-Amino-5-nitro-2-pyridinecarboxylic acid, with the CAS number 84487-13-8, is an organic compound that features a pyridine ring substituted with both amino and nitro groups, as well as a carboxylic acid functional group. This compound typically appears as a solid and is characterized by its ability to participate in various chemical reactions due to the presence of the amino and carboxylic acid functionalities, which can act as both nucleophiles and electrophiles. The nitro group contributes to its electron-withdrawing properties, influencing the compound's reactivity and stability. It is often used in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's solubility can vary depending on the solvent, and it may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro groups can sometimes pose hazards.
Formula:C6H5N3O4
InChI:InChI=1S/C6H5N3O4/c7-3-1-4(6(10)11)8-2-5(3)9(12)13/h1-2H,(H2,7,8)(H,10,11)
InChI key:InChIKey=PSPHQJQRXLPEED-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N)=C(N(=O)=O)C=N1
Synonyms:- 2-Pyridinecarboxylic acid, 4-amino-5-nitro-
- 4-Amino-5-nitro-2-pyridinecarboxylic acid
- 4-Amino-5-nitropyridine-2-carboxylic acid
- 4-Amino-5-nitropicolinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
