CAS 84487-15-0

2-bromo-5-nitro-pyridin-4-amine

Description:

2-Bromo-5-nitro-pyridin-4-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a nitro group at the 5-position, along with an amino group at the 4-position, contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar organic solvents. It exhibits both electrophilic and nucleophilic reactivity due to the electron-withdrawing nature of the nitro group and the electron-donating properties of the amino group. The bromine substituent can participate in various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive functional groups.

Formula: C₅H₄BrN₃O₂

InChI: InChI=1/C5H4BrN3O2/c6-5-1-3(7)4(2-8-5)9(10)11/h1-2H,(H2,7,8)

SMILES: c1c(c(cnc1Br)N(=O)=O)N

Synonyms:

• 2-Bromo-5-Nitropyridin-4-Amine
• 4-Pyridinamine, 2-Bromo-5-Nitro-

2-Bromo-5-nitropyridin-4-amine

CAS: 84487-15-0

Formula: C₅H₄BrN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 218.0082

Ref: IN-DA004S0O

4-Amino-2-bromo-5-nitropyridine

CAS: 84487-15-0

4-Amino-2-bromo-5-nitropyridine

Purity: 95%

Molecular weight: 218.01g/mol

Ref: 54-OR345422

2-Bromo-5-nitropyridin-4-amine

CAS: 84487-15-0

Formula: C₅H₄BrN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 218.01

Ref: 10-F225999

2-bromo-5-nitropyridin-4-amine

CAS: 84487-15-0

Versatile small molecule scaffold

Formula: C₅H₄BrN₃O₂

Purity: Min. 95%

Molecular weight: 218 g/mol

Ref: 3D-JDA48715