CAS 844878-99-5

(4-bromophenyl)(3,4-difluorophenyl)methanone

Description:

(4-bromophenyl)(3,4-difluorophenyl)methanone, with the CAS number 844878-99-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a methanone moiety bonded to two distinct aromatic rings: one containing a bromine substituent and the other containing two fluorine substituents. The presence of these halogen atoms significantly influences the compound's physical and chemical properties, such as its reactivity, polarity, and potential biological activity. Typically, compounds with halogen substituents exhibit enhanced lipophilicity and can participate in various chemical reactions, including electrophilic aromatic substitution. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. Additionally, the compound's stability and solubility characteristics would be influenced by the nature of the substituents, making it a subject of interest in synthetic organic chemistry and material science.

Formula: C₁₃H₇BrF₂O

InChI: InChI=1/C13H7BrF2O/c14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(16)7-9/h1-7H

SMILES: c1cc(ccc1C(=O)c1ccc(c(c1)F)F)Br

Synonyms:

• Methanone, (4-bromophenyl)(3,4-difluorophenyl)-
• (4-Bromophenyl)(3,4-difluorophenyl)methanone

4-Bromo-3',4'-difluorobenzophenone

CAS: 844878-99-5

4-Bromo-3',4'-difluorobenzophenone

Purity: 97%

Molecular weight: 297.09g/mol

Ref: 54-PC2352