CAS 844879-03-4

(4-Bromophenyl)(3,5-difluorophenyl)methanone

Description:

(4-Bromophenyl)(3,5-difluorophenyl)methanone, with the CAS number 844879-03-4, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a bromine atom and two fluorine atoms attached to phenyl rings, contributing to its unique chemical properties. The presence of halogens, such as bromine and fluorine, typically enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often exhibit biological activity. Additionally, the compound may display interesting electronic properties due to the electron-withdrawing effects of the fluorine atoms, which can affect its reactivity in various chemical reactions. Overall, (4-Bromophenyl)(3,5-difluorophenyl)methanone is a notable compound in organic chemistry, particularly for its potential applications in synthetic chemistry and material science.

Formula: C₁₃H₇BrF₂O

InChI: InChI=1S/C13H7BrF2O/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H

InChI key: InChIKey=NSSPHHIIJGNZTB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(Br)C=C2

Synonyms:

• Methanone, (4-bromophenyl)(3,5-difluorophenyl)-
• (4-Bromophenyl)(3,5-difluorophenyl)methanone

4-Bromo-3',5'-difluorobenzophenone

CAS: 844879-03-4

4-Bromo-3',5'-difluorobenzophenone

Purity: 95%

Molecular weight: 297.09g/mol

Ref: 54-PC2358