CymitQuimica logo

CAS 844879-09-0

:

(4-bromophenyl)(3,5-dichlorophenyl)methanone

Description:
(4-bromophenyl)(3,5-dichlorophenyl)methanone, with the CAS number 844879-09-0, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features two aromatic rings: one brominated phenyl group and another phenyl group that is dichlorinated at the 3 and 5 positions. The presence of halogen substituents, such as bromine and chlorine, typically enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and materials science. Additionally, the presence of multiple halogens can affect the compound's electronic properties, potentially making it a candidate for further studies in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C13H7BrCl2O
InChI:InChI=1/C13H7BrCl2O/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H
SMILES:c1cc(ccc1C(=O)c1cc(cc(c1)Cl)Cl)Br
Synonyms:
  • Methanone, (4-bromophenyl)(3,5-dichlorophenyl)-
  • (4-Bromophenyl)(3,5-dichlorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.