CAS 844879-14-7
:(4-Bromophenyl)(4-methoxy-3,5-dimethylphenyl)methanone
Description:
(4-Bromophenyl)(4-methoxy-3,5-dimethylphenyl)methanone, with the CAS number 844879-14-7, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a brominated phenyl group and a methoxy-substituted dimethylphenyl moiety, which contribute to its unique chemical properties. The presence of the bromine atom enhances its reactivity and can influence its electronic properties, while the methoxy group serves as an electron-donating substituent, potentially affecting the compound's solubility and reactivity. The dimethyl substitutions on the phenyl ring can introduce steric hindrance, which may impact the compound's interactions with other molecules. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, (4-Bromophenyl)(4-methoxy-3,5-dimethylphenyl)methanone represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C16H15BrO2
InChI:InChI=1/C16H15BrO2/c1-10-8-13(9-11(2)16(10)19-3)15(18)12-4-6-14(17)7-5-12/h4-9H,1-3H3
InChI key:InChIKey=BHJZYHVNIYTBNZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(OC)C(C)=C1)C2=CC=C(Br)C=C2
Synonyms:- Methanone, (4-bromophenyl)(4-methoxy-3,5-dimethylphenyl)-
- (4-Bromophenyl)(4-methoxy-3,5-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.