CAS 844879-22-7

(4-Bromophenyl)[3-(1-methylethoxy)phenyl]methanone

Description:

(4-Bromophenyl)[3-(1-methylethoxy)phenyl]methanone, with the CAS number 844879-22-7, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a methanone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the bromine atom introduces both electronegative character and potential for reactivity, particularly in electrophilic substitution reactions. The methoxy group enhances solubility in organic solvents and may influence the compound's reactivity and interaction with biological systems. As a ketone, it features a carbonyl group, which is polar and can participate in hydrogen bonding, affecting its physical properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. However, specific applications and safety considerations would depend on further research and analysis.

Formula: C₁₆H₁₅BrO₂

InChI: InChI=1S/C16H15BrO2/c1-11(2)19-15-5-3-4-13(10-15)16(18)12-6-8-14(17)9-7-12/h3-11H,1-2H3

InChI key: InChIKey=GQCXKQGETCWZLF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)C)=CC=C1)C2=CC=C(Br)C=C2

Synonyms:

• (4-Bromophenyl)[3-(1-methylethoxy)phenyl]methanone
• Methanone, (4-bromophenyl)[3-(1-methylethoxy)phenyl]-